C17H15ClN4O2S — CID 24922585
6-[[5-(4-chlorophenyl)-1,2-oxazol-3-yl]methyl]-2-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 24922585) has the molecular formula C17H15ClN4O2S and a molecular weight of 374.85 g/mol. Its IUPAC name is 6-[[5-(4-chlorophenyl)-1,2-oxazol-3-yl]methyl]-2-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[[5-(4-chlorophenyl)-1,2-oxazol-3-yl]methyl]-2-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 24922585 |
| Molecular Formula | C17H15ClN4O2S |
| Molecular Weight | 374.85 g/mol |
| Exact Mass | 374.06 |
| IUPAC Name | 6-[[5-(4-chlorophenyl)-1,2-oxazol-3-yl]methyl]-2-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)[nH]c2c1CN(Cc1cc(-c3ccc(Cl)cc3)on1)CC2 |
| InChI | InChI=1S/C17H15ClN4O2S/c18-11-3-1-10(2-4-11)15-7-12(21-24-15)8-22-6-5-14-13(9-22)16(23)20-17(25)19-14/h1-4,7H,5-6,8-9H2,(H2,19,20,23,25) |
| InChIKey | SCJHOXSOEDIFMP-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 77.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.85 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|