C14H15N3O4S — CID 24924510
2-sulfanylidene-6-[(2,4,6-trihydroxyphenyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 24924510) has the molecular formula C14H15N3O4S and a molecular weight of 321.36 g/mol. Its IUPAC name is 2-sulfanylidene-6-[(2,4,6-trihydroxyphenyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-sulfanylidene-6-[(2,4,6-trihydroxyphenyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 24924510 |
| Molecular Formula | C14H15N3O4S |
| Molecular Weight | 321.36 g/mol |
| Exact Mass | 321.08 |
| IUPAC Name | 2-sulfanylidene-6-[(2,4,6-trihydroxyphenyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)[nH]c2c1CN(Cc1c(O)cc(O)cc1O)CC2 |
| InChI | InChI=1S/C14H15N3O4S/c18-7-3-11(19)9(12(20)4-7)6-17-2-1-10-8(5-17)13(21)16-14(22)15-10/h3-4,18-20H,1-2,5-6H2,(H2,15,16,21,22) |
| InChIKey | XKCZHIPRVWQGAF-UHFFFAOYSA-N |
| XLogP | 1.11 |
| TPSA | 112.58 Ų |
| H-Bond Donors | 5 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.36 |
| LogP ≤ 5 | 1.11 |
| H-Bond Donors ≤ 5 | 5 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|