C15H16FN3O2S — CID 24925476
6-[(2-fluoro-3-methoxyphenyl)methyl]-2-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 24925476) has the molecular formula C15H16FN3O2S and a molecular weight of 321.38 g/mol. Its IUPAC name is 6-[(2-fluoro-3-methoxyphenyl)methyl]-2-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 6-[(2-fluoro-3-methoxyphenyl)methyl]-2-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 24925476 |
| Molecular Formula | C15H16FN3O2S |
| Molecular Weight | 321.38 g/mol |
| Exact Mass | 321.09 |
| IUPAC Name | 6-[(2-fluoro-3-methoxyphenyl)methyl]-2-sulfanylidene-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | COc1cccc(CN2CCc3[nH]c(=S)[nH]c(=O)c3C2)c1F |
| InChI | InChI=1S/C15H16FN3O2S/c1-21-12-4-2-3-9(13(12)16)7-19-6-5-11-10(8-19)14(20)18-15(22)17-11/h2-4H,5-8H2,1H3,(H2,17,18,20,22) |
| InChIKey | MXCDLUXSRJKAJJ-UHFFFAOYSA-N |
| XLogP | 2.14 |
| TPSA | 61.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 321.38 |
| LogP ≤ 5 | 2.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|