C15H14F3N3O2S — CID 24927967
2-sulfanylidene-6-[[4-(trifluoromethoxy)phenyl]methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one (PubChem CID 24927967) has the molecular formula C15H14F3N3O2S and a molecular weight of 357.36 g/mol. Its IUPAC name is 2-sulfanylidene-6-[[4-(trifluoromethoxy)phenyl]methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one.
| Compound Name | 2-sulfanylidene-6-[[4-(trifluoromethoxy)phenyl]methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 24927967 |
| Molecular Formula | C15H14F3N3O2S |
| Molecular Weight | 357.36 g/mol |
| Exact Mass | 357.08 |
| IUPAC Name | 2-sulfanylidene-6-[[4-(trifluoromethoxy)phenyl]methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)[nH]c2c1CN(Cc1ccc(OC(F)(F)F)cc1)CC2 |
| InChI | InChI=1S/C15H14F3N3O2S/c16-15(17,18)23-10-3-1-9(2-4-10)7-21-6-5-12-11(8-21)13(22)20-14(24)19-12/h1-4H,5-8H2,(H2,19,20,22,24) |
| InChIKey | BILADUITPCOXDY-UHFFFAOYSA-N |
| XLogP | 2.89 |
| TPSA | 61.12 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.36 |
| LogP ≤ 5 | 2.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|