C15H14F3N3S — CID 24928187
2-methylsulfanyl-6-[(2,3,6-trifluorophenyl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine (PubChem CID 24928187) has the molecular formula C15H14F3N3S and a molecular weight of 325.36 g/mol. Its IUPAC name is 2-methylsulfanyl-6-[(2,3,6-trifluorophenyl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine.
| Compound Name | 2-methylsulfanyl-6-[(2,3,6-trifluorophenyl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
|---|---|
| PubChem CID | 24928187 |
| Molecular Formula | C15H14F3N3S |
| Molecular Weight | 325.36 g/mol |
| Exact Mass | 325.09 |
| IUPAC Name | 2-methylsulfanyl-6-[(2,3,6-trifluorophenyl)methyl]-7,8-dihydro-5H-pyrido[4,3-d]pyrimidine |
| SMILES | CSc1ncc2c(n1)CCN(Cc1c(F)ccc(F)c1F)C2 |
| InChI | InChI=1S/C15H14F3N3S/c1-22-15-19-6-9-7-21(5-4-13(9)20-15)8-10-11(16)2-3-12(17)14(10)18/h2-3,6H,4-5,7-8H2,1H3 |
| InChIKey | HWHRLSRMTNLGPB-UHFFFAOYSA-N |
| XLogP | 3.17 |
| TPSA | 29.02 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.36 |
| LogP ≤ 5 | 3.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|