C18H23N3O2S — CID 24928240
6-[(2,3-diethoxyphenyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione (PubChem CID 24928240) has the molecular formula C18H23N3O2S and a molecular weight of 345.47 g/mol. Its IUPAC name is 6-[(2,3-diethoxyphenyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione.
| Compound Name | 6-[(2,3-diethoxyphenyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 24928240 |
| Molecular Formula | C18H23N3O2S |
| Molecular Weight | 345.47 g/mol |
| Exact Mass | 345.15 |
| IUPAC Name | 6-[(2,3-diethoxyphenyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
| SMILES | CCOc1cccc(CN2CCc3[nH]c(=S)ncc3C2)c1OCC |
| InChI | InChI=1S/C18H23N3O2S/c1-3-22-16-7-5-6-13(17(16)23-4-2)11-21-9-8-15-14(12-21)10-19-18(24)20-15/h5-7,10H,3-4,8-9,11-12H2,1-2H3,(H,19,20,24) |
| InChIKey | TXTDEAOPDDMTPE-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.47 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|