C15H15F2N3OS — CID 24928912
6-[(2,6-difluoro-4-methoxyphenyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione (PubChem CID 24928912) has the molecular formula C15H15F2N3OS and a molecular weight of 323.37 g/mol. Its IUPAC name is 6-[(2,6-difluoro-4-methoxyphenyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione.
| Compound Name | 6-[(2,6-difluoro-4-methoxyphenyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 24928912 |
| Molecular Formula | C15H15F2N3OS |
| Molecular Weight | 323.37 g/mol |
| Exact Mass | 323.09 |
| IUPAC Name | 6-[(2,6-difluoro-4-methoxyphenyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
| SMILES | COc1cc(F)c(CN2CCc3[nH]c(=S)ncc3C2)c(F)c1 |
| InChI | InChI=1S/C15H15F2N3OS/c1-21-10-4-12(16)11(13(17)5-10)8-20-3-2-14-9(7-20)6-18-15(22)19-14/h4-6H,2-3,7-8H2,1H3,(H,18,19,22) |
| InChIKey | CKGZEVJXFHDISE-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.37 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|