C17H21N3O2S — CID 24929353
6-[(2-ethoxy-3-methoxyphenyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione (PubChem CID 24929353) has the molecular formula C17H21N3O2S and a molecular weight of 331.44 g/mol. Its IUPAC name is 6-[(2-ethoxy-3-methoxyphenyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione.
| Compound Name | 6-[(2-ethoxy-3-methoxyphenyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 24929353 |
| Molecular Formula | C17H21N3O2S |
| Molecular Weight | 331.44 g/mol |
| Exact Mass | 331.14 |
| IUPAC Name | 6-[(2-ethoxy-3-methoxyphenyl)methyl]-1,5,7,8-tetrahydropyrido[4,3-d]pyrimidine-2-thione |
| SMILES | CCOc1c(CN2CCc3[nH]c(=S)ncc3C2)cccc1OC |
| InChI | InChI=1S/C17H21N3O2S/c1-3-22-16-12(5-4-6-15(16)21-2)10-20-8-7-14-13(11-20)9-18-17(23)19-14/h4-6,9H,3,7-8,10-11H2,1-2H3,(H,18,19,23) |
| InChIKey | MVWXRYAHERDZBW-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 50.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.44 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|