C18H16N6O3 — CID 24929671
2-nitro-6-[(2-pyrimidin-5-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]phenol (PubChem CID 24929671) has the molecular formula C18H16N6O3 and a molecular weight of 364.37 g/mol. Its IUPAC name is 2-nitro-6-[(2-pyrimidin-5-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]phenol.
| Compound Name | 2-nitro-6-[(2-pyrimidin-5-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]phenol |
|---|---|
| PubChem CID | 24929671 |
| Molecular Formula | C18H16N6O3 |
| Molecular Weight | 364.37 g/mol |
| Exact Mass | 364.13 |
| IUPAC Name | 2-nitro-6-[(2-pyrimidin-5-yl-7,8-dihydro-5H-pyrido[4,3-d]pyrimidin-6-yl)methyl]phenol |
| SMILES | O=[N+]([O-])c1cccc(CN2CCc3nc(-c4cncnc4)ncc3C2)c1O |
| InChI | InChI=1S/C18H16N6O3/c25-17-12(2-1-3-16(17)24(26)27)9-23-5-4-15-14(10-23)8-21-18(22-15)13-6-19-11-20-7-13/h1-3,6-8,11,25H,4-5,9-10H2 |
| InChIKey | OFLKVPIJQQUXTB-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 118.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.37 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'mannich_A(296)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|