C15H17N3OS — CID 24930182
7-[(3-methoxyphenyl)methyl]-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-2-thione (PubChem CID 24930182) has the molecular formula C15H17N3OS and a molecular weight of 287.39 g/mol. Its IUPAC name is 7-[(3-methoxyphenyl)methyl]-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-2-thione.
| Compound Name | 7-[(3-methoxyphenyl)methyl]-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 24930182 |
| Molecular Formula | C15H17N3OS |
| Molecular Weight | 287.39 g/mol |
| Exact Mass | 287.11 |
| IUPAC Name | 7-[(3-methoxyphenyl)methyl]-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-2-thione |
| SMILES | COc1cccc(CN2CCc3cnc(=S)[nH]c3C2)c1 |
| InChI | InChI=1S/C15H17N3OS/c1-19-13-4-2-3-11(7-13)9-18-6-5-12-8-16-15(20)17-14(12)10-18/h2-4,7-8H,5-6,9-10H2,1H3,(H,16,17,20) |
| InChIKey | YDPDDFSACRLUPF-UHFFFAOYSA-N |
| XLogP | 2.71 |
| TPSA | 41.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 287.39 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|