C11H13N5S — CID 24931337
7-(1H-imidazol-2-ylmethyl)-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-2-thione (PubChem CID 24931337) has the molecular formula C11H13N5S and a molecular weight of 247.33 g/mol. Its IUPAC name is 7-(1H-imidazol-2-ylmethyl)-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-2-thione.
| Compound Name | 7-(1H-imidazol-2-ylmethyl)-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-2-thione |
|---|---|
| PubChem CID | 24931337 |
| Molecular Formula | C11H13N5S |
| Molecular Weight | 247.33 g/mol |
| Exact Mass | 247.09 |
| IUPAC Name | 7-(1H-imidazol-2-ylmethyl)-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidine-2-thione |
| SMILES | S=c1ncc2c([nH]1)CN(Cc1ncc[nH]1)CC2 |
| InChI | InChI=1S/C11H13N5S/c17-11-14-5-8-1-4-16(6-9(8)15-11)7-10-12-2-3-13-10/h2-3,5H,1,4,6-7H2,(H,12,13)(H,14,15,17) |
| InChIKey | TYELXCFYYBOLFD-UHFFFAOYSA-N |
| XLogP | 1.42 |
| TPSA | 60.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.33 |
| LogP ≤ 5 | 1.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|