C14H13F2N3OS — CID 24932450
7-[(2,5-difluorophenyl)methyl]-2-sulfanylidene-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 24932450) has the molecular formula C14H13F2N3OS and a molecular weight of 309.34 g/mol. Its IUPAC name is 7-[(2,5-difluorophenyl)methyl]-2-sulfanylidene-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 7-[(2,5-difluorophenyl)methyl]-2-sulfanylidene-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 24932450 |
| Molecular Formula | C14H13F2N3OS |
| Molecular Weight | 309.34 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 7-[(2,5-difluorophenyl)methyl]-2-sulfanylidene-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | O=c1[nH]c(=S)[nH]c2c1CCN(Cc1cc(F)ccc1F)C2 |
| InChI | InChI=1S/C14H13F2N3OS/c15-9-1-2-11(16)8(5-9)6-19-4-3-10-12(7-19)17-14(21)18-13(10)20/h1-2,5H,3-4,6-7H2,(H2,17,18,20,21) |
| InChIKey | FBPPAGZOYBTTQH-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 51.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 309.34 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|