C16H18ClN3O3S — CID 24932744
7-[(2-chloro-3,4-dimethoxyphenyl)methyl]-2-sulfanylidene-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one (PubChem CID 24932744) has the molecular formula C16H18ClN3O3S and a molecular weight of 367.86 g/mol. Its IUPAC name is 7-[(2-chloro-3,4-dimethoxyphenyl)methyl]-2-sulfanylidene-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one.
| Compound Name | 7-[(2-chloro-3,4-dimethoxyphenyl)methyl]-2-sulfanylidene-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
|---|---|
| PubChem CID | 24932744 |
| Molecular Formula | C16H18ClN3O3S |
| Molecular Weight | 367.86 g/mol |
| Exact Mass | 367.08 |
| IUPAC Name | 7-[(2-chloro-3,4-dimethoxyphenyl)methyl]-2-sulfanylidene-1,5,6,8-tetrahydropyrido[3,4-d]pyrimidin-4-one |
| SMILES | COc1ccc(CN2CCc3c([nH]c(=S)[nH]c3=O)C2)c(Cl)c1OC |
| InChI | InChI=1S/C16H18ClN3O3S/c1-22-12-4-3-9(13(17)14(12)23-2)7-20-6-5-10-11(8-20)18-16(24)19-15(10)21/h3-4H,5-8H2,1-2H3,(H2,18,19,21,24) |
| InChIKey | UMABKCRHILSFAT-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 70.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.86 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|