C14H14N6O2 — CID 24936051
5-(6-morpholin-4-yl-7H-purin-2-yl)pyridin-3-ol (PubChem CID 24936051) has the molecular formula C14H14N6O2 and a molecular weight of 298.31 g/mol. Its IUPAC name is 5-(6-morpholin-4-yl-7H-purin-2-yl)pyridin-3-ol.
| Compound Name | 5-(6-morpholin-4-yl-7H-purin-2-yl)pyridin-3-ol |
|---|---|
| PubChem CID | 24936051 |
| Molecular Formula | C14H14N6O2 |
| Molecular Weight | 298.31 g/mol |
| Exact Mass | 298.12 |
| IUPAC Name | 5-(6-morpholin-4-yl-7H-purin-2-yl)pyridin-3-ol |
| SMILES | Oc1cncc(-c2nc(N3CCOCC3)c3[nH]cnc3n2)c1 |
| InChI | InChI=1S/C14H14N6O2/c21-10-5-9(6-15-7-10)12-18-13-11(16-8-17-13)14(19-12)20-1-3-22-4-2-20/h5-8,21H,1-4H2,(H,16,17,18,19) |
| InChIKey | WJXACEILBUSAPK-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 100.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.31 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |