C29H32N6O5S — CID 24936338
8-(2,3-dihydro-1H-inden-5-yl)-N-methoxy-2-[4-[2-(2-methylsulfonylethylamino)ethyl]anilino]-5-oxopyrido[2,3-d]pyrimidine-6-carboxamide (PubChem CID 24936338) has the molecular formula C29H32N6O5S and a molecular weight of 576.68 g/mol. Its IUPAC name is 8-(2,3-dihydro-1H-inden-5-yl)-N-methoxy-2-[4-[2-(2-methylsulfonylethylamino)ethyl]anilino]-5-oxopyrido[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 8-(2,3-dihydro-1H-inden-5-yl)-N-methoxy-2-[4-[2-(2-methylsulfonylethylamino)ethyl]anilino]-5-oxopyrido[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 24936338 |
| Molecular Formula | C29H32N6O5S |
| Molecular Weight | 576.68 g/mol |
| Exact Mass | 576.22 |
| IUPAC Name | 8-(2,3-dihydro-1H-inden-5-yl)-N-methoxy-2-[4-[2-(2-methylsulfonylethylamino)ethyl]anilino]-5-oxopyrido[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CONC(=O)c1cn(-c2ccc3c(c2)CCC3)c2nc(Nc3ccc(CCNCCS(C)(=O)=O)cc3)ncc2c1=O |
| InChI | InChI=1S/C29H32N6O5S/c1-40-34-28(37)25-18-35(23-11-8-20-4-3-5-21(20)16-23)27-24(26(25)36)17-31-29(33-27)32-22-9-6-19(7-10-22)12-13-30-14-15-41(2,38)39/h6-11,16-18,30H,3-5,12-15H2,1-2H3,(H,34,37)(H,31,32,33) |
| InChIKey | HRVDYXLBRPKAGZ-UHFFFAOYSA-N |
| XLogP | 2.48 |
| TPSA | 144.31 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 41 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 576.68 |
| LogP ≤ 5 | 2.48 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|