C26H31F3N4O3 — CID 24936369
N'-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N-[2-(dimethylamino)ethyl]oxamide (PubChem CID 24936369) has the molecular formula C26H31F3N4O3 and a molecular weight of 504.55 g/mol. Its IUPAC name is N'-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N-[2-(dimethylamino)ethyl]oxamide.
| Compound Name | N'-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N-[2-(dimethylamino)ethyl]oxamide |
|---|---|
| PubChem CID | 24936369 |
| Molecular Formula | C26H31F3N4O3 |
| Molecular Weight | 504.55 g/mol |
| Exact Mass | 504.23 |
| IUPAC Name | N'-[[(2R,4aS,5R,10bS)-5-phenyl-9-(trifluoromethyl)-3,4,4a,5,6,10b-hexahydro-2H-pyrano[3,2-c]quinolin-2-yl]methyl]-N-[2-(dimethylamino)ethyl]oxamide |
| SMILES | CN(C)CCNC(=O)C(=O)NC[C@H]1CC[C@@H]2[C@H](O1)c1cc(C(F)(F)F)ccc1N[C@H]2c1ccccc1 |
| InChI | InChI=1S/C26H31F3N4O3/c1-33(2)13-12-30-24(34)25(35)31-15-18-9-10-19-22(16-6-4-3-5-7-16)32-21-11-8-17(26(27,28)29)14-20(21)23(19)36-18/h3-8,11,14,18-19,22-23,32H,9-10,12-13,15H2,1-2H3,(H,30,34)(H,31,35)/t18-,19+,22+,23+/m1/s1 |
| InChIKey | OWYKLCRSZKWKNF-FUKQBSRTSA-N |
| XLogP | 3.50 |
| TPSA | 82.70 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.55 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|