C20H24IN5O2S — CID 24936379
1-[2-(2,2-dimethylpropylamino)ethyl]-2-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]imidazo[4,5-c]pyridin-4-amine (PubChem CID 24936379) has the molecular formula C20H24IN5O2S and a molecular weight of 525.42 g/mol. Its IUPAC name is 1-[2-(2,2-dimethylpropylamino)ethyl]-2-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]imidazo[4,5-c]pyridin-4-amine.
| Compound Name | 1-[2-(2,2-dimethylpropylamino)ethyl]-2-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]imidazo[4,5-c]pyridin-4-amine |
|---|---|
| PubChem CID | 24936379 |
| Molecular Formula | C20H24IN5O2S |
| Molecular Weight | 525.42 g/mol |
| Exact Mass | 525.07 |
| IUPAC Name | 1-[2-(2,2-dimethylpropylamino)ethyl]-2-[(6-iodo-1,3-benzodioxol-5-yl)sulfanyl]imidazo[4,5-c]pyridin-4-amine |
| SMILES | CC(C)(C)CNCCn1c(Sc2cc3c(cc2I)OCO3)nc2c(N)nccc21 |
| InChI | InChI=1S/C20H24IN5O2S/c1-20(2,3)10-23-6-7-26-13-4-5-24-18(22)17(13)25-19(26)29-16-9-15-14(8-12(16)21)27-11-28-15/h4-5,8-9,23H,6-7,10-11H2,1-3H3,(H2,22,24) |
| InChIKey | XOPONTTYDVZJQD-UHFFFAOYSA-N |
| XLogP | 4.13 |
| TPSA | 87.22 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 525.42 |
| LogP ≤ 5 | 4.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|