C30H31N7O3 — CID 24936602
8-(4-ethynylphenyl)-N-methoxy-2-[4-[2-(4-methylpiperazin-1-yl)ethyl]anilino]-5-oxopyrido[2,3-d]pyrimidine-6-carboxamide (PubChem CID 24936602) has the molecular formula C30H31N7O3 and a molecular weight of 537.62 g/mol. Its IUPAC name is 8-(4-ethynylphenyl)-N-methoxy-2-[4-[2-(4-methylpiperazin-1-yl)ethyl]anilino]-5-oxopyrido[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 8-(4-ethynylphenyl)-N-methoxy-2-[4-[2-(4-methylpiperazin-1-yl)ethyl]anilino]-5-oxopyrido[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 24936602 |
| Molecular Formula | C30H31N7O3 |
| Molecular Weight | 537.62 g/mol |
| Exact Mass | 537.25 |
| IUPAC Name | 8-(4-ethynylphenyl)-N-methoxy-2-[4-[2-(4-methylpiperazin-1-yl)ethyl]anilino]-5-oxopyrido[2,3-d]pyrimidine-6-carboxamide |
| SMILES | C#Cc1ccc(-n2cc(C(=O)NOC)c(=O)c3cnc(Nc4ccc(CCN5CCN(C)CC5)cc4)nc32)cc1 |
| InChI | InChI=1S/C30H31N7O3/c1-4-21-7-11-24(12-8-21)37-20-26(29(39)34-40-3)27(38)25-19-31-30(33-28(25)37)32-23-9-5-22(6-10-23)13-14-36-17-15-35(2)16-18-36/h1,5-12,19-20H,13-18H2,2-3H3,(H,34,39)(H,31,32,33) |
| InChIKey | XHGKBUINDCZVHY-UHFFFAOYSA-N |
| XLogP | 2.59 |
| TPSA | 104.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 537.62 |
| LogP ≤ 5 | 2.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|