C18H10F3N5O3 — CID 24936725
2-(3-hydroxyphenyl)-8-oxo-9-(2,3,4-trifluorophenyl)-7H-purine-6-carboxamide (PubChem CID 24936725) has the molecular formula C18H10F3N5O3 and a molecular weight of 401.30 g/mol. Its IUPAC name is 2-(3-hydroxyphenyl)-8-oxo-9-(2,3,4-trifluorophenyl)-7H-purine-6-carboxamide.
| Compound Name | 2-(3-hydroxyphenyl)-8-oxo-9-(2,3,4-trifluorophenyl)-7H-purine-6-carboxamide |
|---|---|
| PubChem CID | 24936725 |
| Molecular Formula | C18H10F3N5O3 |
| Molecular Weight | 401.30 g/mol |
| Exact Mass | 401.07 |
| IUPAC Name | 2-(3-hydroxyphenyl)-8-oxo-9-(2,3,4-trifluorophenyl)-7H-purine-6-carboxamide |
| SMILES | NC(=O)c1nc(-c2cccc(O)c2)nc2c1[nH]c(=O)n2-c1ccc(F)c(F)c1F |
| InChI | InChI=1S/C18H10F3N5O3/c19-9-4-5-10(12(21)11(9)20)26-17-14(24-18(26)29)13(15(22)28)23-16(25-17)7-2-1-3-8(27)6-7/h1-6,27H,(H2,22,28)(H,24,29) |
| InChIKey | NGAYUFFYWLUMGP-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 126.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.30 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|