C25H30N6O3 — CID 24936989
8-cyclopentyl-N-methoxy-5-oxo-2-(4-piperidin-4-ylanilino)pyrido[2,3-d]pyrimidine-6-carboxamide (PubChem CID 24936989) has the molecular formula C25H30N6O3 and a molecular weight of 462.55 g/mol. Its IUPAC name is 8-cyclopentyl-N-methoxy-5-oxo-2-(4-piperidin-4-ylanilino)pyrido[2,3-d]pyrimidine-6-carboxamide.
| Compound Name | 8-cyclopentyl-N-methoxy-5-oxo-2-(4-piperidin-4-ylanilino)pyrido[2,3-d]pyrimidine-6-carboxamide |
|---|---|
| PubChem CID | 24936989 |
| Molecular Formula | C25H30N6O3 |
| Molecular Weight | 462.55 g/mol |
| Exact Mass | 462.24 |
| IUPAC Name | 8-cyclopentyl-N-methoxy-5-oxo-2-(4-piperidin-4-ylanilino)pyrido[2,3-d]pyrimidine-6-carboxamide |
| SMILES | CONC(=O)c1cn(C2CCCC2)c2nc(Nc3ccc(C4CCNCC4)cc3)ncc2c1=O |
| InChI | InChI=1S/C25H30N6O3/c1-34-30-24(33)21-15-31(19-4-2-3-5-19)23-20(22(21)32)14-27-25(29-23)28-18-8-6-16(7-9-18)17-10-12-26-13-11-17/h6-9,14-15,17,19,26H,2-5,10-13H2,1H3,(H,30,33)(H,27,28,29) |
| InChIKey | CGXJZEPTWQQPCE-UHFFFAOYSA-N |
| XLogP | 3.41 |
| TPSA | 110.17 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.55 |
| LogP ≤ 5 | 3.41 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|