C16H17F2N3O2S — CID 24937255
3-[3-(2,5-difluorophenyl)-2,2-dioxo-2λ6,1,3-benzothiadiazol-1-yl]-N-methylpropan-1-amine (PubChem CID 24937255) has the molecular formula C16H17F2N3O2S and a molecular weight of 353.39 g/mol. Its IUPAC name is 3-[3-(2,5-difluorophenyl)-2,2-dioxo-2λ6,1,3-benzothiadiazol-1-yl]-N-methylpropan-1-amine.
| Compound Name | 3-[3-(2,5-difluorophenyl)-2,2-dioxo-2λ6,1,3-benzothiadiazol-1-yl]-N-methylpropan-1-amine |
|---|---|
| PubChem CID | 24937255 |
| Molecular Formula | C16H17F2N3O2S |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.10 |
| IUPAC Name | 3-[3-(2,5-difluorophenyl)-2,2-dioxo-2λ6,1,3-benzothiadiazol-1-yl]-N-methylpropan-1-amine |
| SMILES | CNCCCN1c2ccccc2N(c2cc(F)ccc2F)S1(=O)=O |
| InChI | InChI=1S/C16H17F2N3O2S/c1-19-9-4-10-20-14-5-2-3-6-15(14)21(24(20,22)23)16-11-12(17)7-8-13(16)18/h2-3,5-8,11,19H,4,9-10H2,1H3 |
| InChIKey | GCYYBJSVDYXFCP-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 52.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|