C22H25F2NO4S — CID 24937318
(2S,3R)-8-(3,4-difluorophenyl)-7-heptyl-2-methoxy-5-oxo-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylic acid (PubChem CID 24937318) has the molecular formula C22H25F2NO4S and a molecular weight of 437.51 g/mol. Its IUPAC name is (2S,3R)-8-(3,4-difluorophenyl)-7-heptyl-2-methoxy-5-oxo-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylic acid.
| Compound Name | (2S,3R)-8-(3,4-difluorophenyl)-7-heptyl-2-methoxy-5-oxo-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylic acid |
|---|---|
| PubChem CID | 24937318 |
| Molecular Formula | C22H25F2NO4S |
| Molecular Weight | 437.51 g/mol |
| Exact Mass | 437.15 |
| IUPAC Name | (2S,3R)-8-(3,4-difluorophenyl)-7-heptyl-2-methoxy-5-oxo-2,3-dihydro-[1,3]thiazolo[3,2-a]pyridine-3-carboxylic acid |
| SMILES | CCCCCCCc1cc(=O)n2c(c1-c1ccc(F)c(F)c1)S[C@H](OC)[C@H]2C(=O)O |
| InChI | InChI=1S/C22H25F2NO4S/c1-3-4-5-6-7-8-13-12-17(26)25-19(21(27)28)22(29-2)30-20(25)18(13)14-9-10-15(23)16(24)11-14/h9-12,19,22H,3-8H2,1-2H3,(H,27,28)/t19-,22+/m1/s1 |
| InChIKey | IPPMNUUMGZDPET-KNQAVFIVSA-N |
| XLogP | 5.01 |
| TPSA | 68.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.51 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|