About N-[3-chloro-4-(2,4-difluorophenyl)phenyl]-1-pyrimidin-2-ylpiperidin-4-amine
N-[3-chloro-4-(2,4-difluorophenyl)phenyl]-1-pyrimidin-2-ylpiperidin-4-amine (PubChem CID 24937476) has the molecular formula C21H19ClF2N4
and a molecular weight of 400.86 g/mol. Its IUPAC name is N-[3-chloro-4-(2,4-difluorophenyl)phenyl]-1-pyrimidin-2-ylpiperidin-4-amine.
Molecular Properties
| Compound Name | N-[3-chloro-4-(2,4-difluorophenyl)phenyl]-1-pyrimidin-2-ylpiperidin-4-amine |
| PubChem CID | 24937476 |
| Molecular Formula | C21H19ClF2N4 |
| Molecular Weight | 400.86 g/mol |
| Exact Mass | 400.13 |
| IUPAC Name | N-[3-chloro-4-(2,4-difluorophenyl)phenyl]-1-pyrimidin-2-ylpiperidin-4-amine |
| SMILES | Fc1ccc(-c2ccc(NC3CCN(c4ncccn4)CC3)cc2Cl)c(F)c1 |
| InChI | InChI=1S/C21H19ClF2N4/c22-19-13-16(3-5-17(19)18-4-2-14(23)12-20(18)24)27-15-6-10-28(11-7-15)21-25-8-1-9-26-21/h1-5,8-9,12-13,15,27H,6-7,10-11H2 |
| InChIKey | UXGWCEARHMHGOL-UHFFFAOYSA-N |
| XLogP | 5.16 |
| TPSA | 41.05 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 400.86 |
| LogP ≤ 5 | 5.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze N-[3-chloro-4-(2,4-difluorophenyl)phenyl]-1-pyrimidin-2-ylpiperidin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[3-chloro-4-(2,4-difluorophenyl)phenyl]-1-pyrimidin-2-ylpiperidin-4-amine?
The IUPAC name of N-[3-chloro-4-(2,4-difluorophenyl)phenyl]-1-pyrimidin-2-ylpiperidin-4-amine (CID 24937476) is N-[3-chloro-4-(2,4-difluorophenyl)phenyl]-1-pyrimidin-2-ylpiperidin-4-amine.
What is the SMILES notation for N-[3-chloro-4-(2,4-difluorophenyl)phenyl]-1-pyrimidin-2-ylpiperidin-4-amine?
The canonical SMILES for N-[3-chloro-4-(2,4-difluorophenyl)phenyl]-1-pyrimidin-2-ylpiperidin-4-amine is Fc1ccc(-c2ccc(NC3CCN(c4ncccn4)CC3)cc2Cl)c(F)c1.
What is the InChIKey of N-[3-chloro-4-(2,4-difluorophenyl)phenyl]-1-pyrimidin-2-ylpiperidin-4-amine?
The InChIKey is UXGWCEARHMHGOL-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H19ClF2N4/c22-19-13-16(3-5-17(19)18-4-2-14(23)12-20(18)24)27-15-6-10-28(11-7-15)21-25-8-1-9-26-21/h1-5,8-9,12-13,15,27H,6-7,10-11H2.
What are the key properties of N-[3-chloro-4-(2,4-difluorophenyl)phenyl]-1-pyrimidin-2-ylpiperidin-4-amine?
N-[3-chloro-4-(2,4-difluorophenyl)phenyl]-1-pyrimidin-2-ylpiperidin-4-amine has a molecular weight of 400.86 g/mol, XLogP of 5.16, 4 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-[3-chloro-4-(2,4-difluorophenyl)phenyl]-1-pyrimidin-2-ylpiperidin-4-amine is sourced from PubChem (CID 24937476), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).