C31H33ClN2O3S — CID 24938155
3-[[4-[1-(4-chlorophenyl)-1-[5-(sulfanylmethyl)-1H-indol-3-yl]hexan-2-yl]benzoyl]amino]propanoic acid (PubChem CID 24938155) has the molecular formula C31H33ClN2O3S and a molecular weight of 549.14 g/mol. Its IUPAC name is 3-[[4-[1-(4-chlorophenyl)-1-[5-(sulfanylmethyl)-1H-indol-3-yl]hexan-2-yl]benzoyl]amino]propanoic acid.
| Compound Name | 3-[[4-[1-(4-chlorophenyl)-1-[5-(sulfanylmethyl)-1H-indol-3-yl]hexan-2-yl]benzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 24938155 |
| Molecular Formula | C31H33ClN2O3S |
| Molecular Weight | 549.14 g/mol |
| Exact Mass | 548.19 |
| IUPAC Name | 3-[[4-[1-(4-chlorophenyl)-1-[5-(sulfanylmethyl)-1H-indol-3-yl]hexan-2-yl]benzoyl]amino]propanoic acid |
| SMILES | CCCCC(c1ccc(C(=O)NCCC(=O)O)cc1)C(c1ccc(Cl)cc1)c1c[nH]c2ccc(CS)cc12 |
| InChI | InChI=1S/C31H33ClN2O3S/c1-2-3-4-25(21-6-8-23(9-7-21)31(37)33-16-15-29(35)36)30(22-10-12-24(32)13-11-22)27-18-34-28-14-5-20(19-38)17-26(27)28/h5-14,17-18,25,30,34,38H,2-4,15-16,19H2,1H3,(H,33,37)(H,35,36) |
| InChIKey | NDDBXFRVEVTQMZ-UHFFFAOYSA-N |
| XLogP | 7.56 |
| TPSA | 82.19 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.14 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|