C23H26O8Si — CID 24938328
7-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-8-hydroxy-3-(4-trimethylsilylphenyl)chromen-4-one (PubChem CID 24938328) has the molecular formula C23H26O8Si and a molecular weight of 458.54 g/mol. Its IUPAC name is 7-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-8-hydroxy-3-(4-trimethylsilylphenyl)chromen-4-one.
| Compound Name | 7-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-8-hydroxy-3-(4-trimethylsilylphenyl)chromen-4-one |
|---|---|
| PubChem CID | 24938328 |
| Molecular Formula | C23H26O8Si |
| Molecular Weight | 458.54 g/mol |
| Exact Mass | 458.14 |
| IUPAC Name | 7-[(2R,3S,4S,5R)-3,4-dihydroxy-5-(hydroxymethyl)oxolan-2-yl]oxy-8-hydroxy-3-(4-trimethylsilylphenyl)chromen-4-one |
| SMILES | C[Si](C)(C)c1ccc(-c2coc3c(O)c(O[C@H]4O[C@H](CO)[C@@H](O)[C@@H]4O)ccc3c2=O)cc1 |
| InChI | InChI=1S/C23H26O8Si/c1-32(2,3)13-6-4-12(5-7-13)15-11-29-22-14(18(15)25)8-9-16(20(22)27)30-23-21(28)19(26)17(10-24)31-23/h4-9,11,17,19,21,23-24,26-28H,10H2,1-3H3/t17-,19-,21+,23+/m1/s1 |
| InChIKey | FUKLAJKVQRVDBA-YZBYQZESSA-N |
| XLogP | 1.53 |
| TPSA | 129.59 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.54 |
| LogP ≤ 5 | 1.53 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|