C19H17NO — CID 24938871
1,5-dibenzylpyridin-2-one (PubChem CID 24938871) has the molecular formula C19H17NO and a molecular weight of 275.35 g/mol. Its IUPAC name is 1,5-dibenzylpyridin-2-one.
| Compound Name | 1,5-dibenzylpyridin-2-one |
|---|---|
| PubChem CID | 24938871 |
| Molecular Formula | C19H17NO |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 1,5-dibenzylpyridin-2-one |
| SMILES | O=c1ccc(Cc2ccccc2)cn1Cc1ccccc1 |
| InChI | InChI=1S/C19H17NO/c21-19-12-11-18(13-16-7-3-1-4-8-16)15-20(19)14-17-9-5-2-6-10-17/h1-12,15H,13-14H2 |
| InChIKey | WMAKWQLIDUNMQY-UHFFFAOYSA-N |
| XLogP | 3.49 |
| TPSA | 22.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 3.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |