About [(1S,2S,4S)-2-formyl-2-bicyclo[2.2.1]hept-5-enyl] cyclohexanecarboxylate
[(1S,2S,4S)-2-formyl-2-bicyclo[2.2.1]hept-5-enyl] cyclohexanecarboxylate (PubChem CID 24938932) has the molecular formula C15H20O3
and a molecular weight of 248.32 g/mol. Its IUPAC name is [(1S,2S,4S)-2-formyl-2-bicyclo[2.2.1]hept-5-enyl] cyclohexanecarboxylate.
Molecular Properties
| Compound Name | [(1S,2S,4S)-2-formyl-2-bicyclo[2.2.1]hept-5-enyl] cyclohexanecarboxylate |
| PubChem CID | 24938932 |
| Molecular Formula | C15H20O3 |
| Molecular Weight | 248.32 g/mol |
| Exact Mass | 248.14 |
| IUPAC Name | [(1S,2S,4S)-2-formyl-2-bicyclo[2.2.1]hept-5-enyl] cyclohexanecarboxylate |
| SMILES | O=C[C@]1(OC(=O)C2CCCCC2)C[C@H]2C=C[C@@H]1C2 |
| InChI | InChI=1S/C15H20O3/c16-10-15(9-11-6-7-13(15)8-11)18-14(17)12-4-2-1-3-5-12/h6-7,10-13H,1-5,8-9H2/t11-,13+,15+/m0/s1 |
| InChIKey | ULGJTGNVUJAXEY-NJZAAPMLSA-N |
| XLogP | 2.64 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 248.32 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze [(1S,2S,4S)-2-formyl-2-bicyclo[2.2.1]hept-5-enyl] cyclohexanecarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(1S,2S,4S)-2-formyl-2-bicyclo[2.2.1]hept-5-enyl] cyclohexanecarboxylate?
The IUPAC name of [(1S,2S,4S)-2-formyl-2-bicyclo[2.2.1]hept-5-enyl] cyclohexanecarboxylate (CID 24938932) is [(1S,2S,4S)-2-formyl-2-bicyclo[2.2.1]hept-5-enyl] cyclohexanecarboxylate.
What is the SMILES notation for [(1S,2S,4S)-2-formyl-2-bicyclo[2.2.1]hept-5-enyl] cyclohexanecarboxylate?
The canonical SMILES for [(1S,2S,4S)-2-formyl-2-bicyclo[2.2.1]hept-5-enyl] cyclohexanecarboxylate is O=C[C@]1(OC(=O)C2CCCCC2)C[C@H]2C=C[C@@H]1C2.
What is the InChIKey of [(1S,2S,4S)-2-formyl-2-bicyclo[2.2.1]hept-5-enyl] cyclohexanecarboxylate?
The InChIKey is ULGJTGNVUJAXEY-NJZAAPMLSA-N. The full InChI is InChI=1S/C15H20O3/c16-10-15(9-11-6-7-13(15)8-11)18-14(17)12-4-2-1-3-5-12/h6-7,10-13H,1-5,8-9H2/t11-,13+,15+/m0/s1.
What are the key properties of [(1S,2S,4S)-2-formyl-2-bicyclo[2.2.1]hept-5-enyl] cyclohexanecarboxylate?
[(1S,2S,4S)-2-formyl-2-bicyclo[2.2.1]hept-5-enyl] cyclohexanecarboxylate has a molecular weight of 248.32 g/mol, XLogP of 2.64, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for [(1S,2S,4S)-2-formyl-2-bicyclo[2.2.1]hept-5-enyl] cyclohexanecarboxylate is sourced from PubChem (CID 24938932), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).