About 1-cyclohexylpyrrole-2,5-dione;3-methylfluoranthene
1-cyclohexylpyrrole-2,5-dione;3-methylfluoranthene (PubChem CID 24939025) has the molecular formula C27H25NO2
and a molecular weight of 395.50 g/mol. Its IUPAC name is 1-cyclohexylpyrrole-2,5-dione;3-methylfluoranthene.
Molecular Properties
| Compound Name | 1-cyclohexylpyrrole-2,5-dione;3-methylfluoranthene |
| PubChem CID | 24939025 |
| Molecular Formula | C27H25NO2 |
| Molecular Weight | 395.50 g/mol |
| Exact Mass | 395.19 |
| IUPAC Name | 1-cyclohexylpyrrole-2,5-dione;3-methylfluoranthene |
| SMILES | Cc1ccc2c3c(cccc13)-c1ccccc1-2.O=C1C=CC(=O)N1C1CCCCC1 |
| InChI | InChI=1S/C17H12.C10H13NO2/c1-11-9-10-16-14-6-3-2-5-13(14)15-8-4-7-12(11)17(15)16;12-9-6-7-10(13)11(9)8-4-2-1-3-5-8/h2-10H,1H3;6-8H,1-5H2 |
| InChIKey | MVQCWZJEQGMDPF-UHFFFAOYSA-N |
| XLogP | 6.04 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 395.50 |
| LogP ≤ 5 | 6.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|
Analyze 1-cyclohexylpyrrole-2,5-dione;3-methylfluoranthene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclohexylpyrrole-2,5-dione;3-methylfluoranthene?
The IUPAC name of 1-cyclohexylpyrrole-2,5-dione;3-methylfluoranthene (CID 24939025) is 1-cyclohexylpyrrole-2,5-dione;3-methylfluoranthene.
What is the SMILES notation for 1-cyclohexylpyrrole-2,5-dione;3-methylfluoranthene?
The canonical SMILES for 1-cyclohexylpyrrole-2,5-dione;3-methylfluoranthene is Cc1ccc2c3c(cccc13)-c1ccccc1-2.O=C1C=CC(=O)N1C1CCCCC1.
What is the InChIKey of 1-cyclohexylpyrrole-2,5-dione;3-methylfluoranthene?
The InChIKey is MVQCWZJEQGMDPF-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H12.C10H13NO2/c1-11-9-10-16-14-6-3-2-5-13(14)15-8-4-7-12(11)17(15)16;12-9-6-7-10(13)11(9)8-4-2-1-3-5-8/h2-10H,1H3;6-8H,1-5H2.
What are the key properties of 1-cyclohexylpyrrole-2,5-dione;3-methylfluoranthene?
1-cyclohexylpyrrole-2,5-dione;3-methylfluoranthene has a molecular weight of 395.50 g/mol, XLogP of 6.04, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclohexylpyrrole-2,5-dione;3-methylfluoranthene is sourced from PubChem (CID 24939025), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).