C25H50O4Si2 — CID 24939034
[(3aS,4S,6R,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-6-(methoxymethoxy)-7a-methyl-1,3a,4,5,6,7-hexahydroinden-4-yl]methoxy-tert-butyl-dimethylsilane (PubChem CID 24939034) has the molecular formula C25H50O4Si2 and a molecular weight of 470.84 g/mol. Its IUPAC name is [(3aS,4S,6R,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-6-(methoxymethoxy)-7a-methyl-1,3a,4,5,6,7-hexahydroinden-4-yl]methoxy-tert-butyl-dimethylsilane.
| Compound Name | [(3aS,4S,6R,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-6-(methoxymethoxy)-7a-methyl-1,3a,4,5,6,7-hexahydroinden-4-yl]methoxy-tert-butyl-dimethylsilane |
|---|---|
| PubChem CID | 24939034 |
| Molecular Formula | C25H50O4Si2 |
| Molecular Weight | 470.84 g/mol |
| Exact Mass | 470.32 |
| IUPAC Name | [(3aS,4S,6R,7R,7aS)-7-[tert-butyl(dimethyl)silyl]oxy-6-(methoxymethoxy)-7a-methyl-1,3a,4,5,6,7-hexahydroinden-4-yl]methoxy-tert-butyl-dimethylsilane |
| SMILES | COCO[C@@H]1C[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H]2C=CC[C@]2(C)[C@H]1O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H50O4Si2/c1-23(2,3)30(9,10)28-17-19-16-21(27-18-26-8)22(25(7)15-13-14-20(19)25)29-31(11,12)24(4,5)6/h13-14,19-22H,15-18H2,1-12H3/t19-,20+,21-,22+,25+/m1/s1 |
| InChIKey | IATBBUVJTIEDCL-SDPNRYTFSA-N |
| XLogP | 6.99 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.84 |
| LogP ≤ 5 | 6.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|