C25H37N5O5 — CID 24939074
(3S)-7-butan-2-yl-3-methyl-10-[(1S)-1-phenylethyl]-1,4,7,10,14-pentazacycloheptadecane-2,5,8,11,15-pentone (PubChem CID 24939074) has the molecular formula C25H37N5O5 and a molecular weight of 487.60 g/mol. Its IUPAC name is (3S)-7-butan-2-yl-3-methyl-10-[(1S)-1-phenylethyl]-1,4,7,10,14-pentazacycloheptadecane-2,5,8,11,15-pentone.
| Compound Name | (3S)-7-butan-2-yl-3-methyl-10-[(1S)-1-phenylethyl]-1,4,7,10,14-pentazacycloheptadecane-2,5,8,11,15-pentone |
|---|---|
| PubChem CID | 24939074 |
| Molecular Formula | C25H37N5O5 |
| Molecular Weight | 487.60 g/mol |
| Exact Mass | 487.28 |
| IUPAC Name | (3S)-7-butan-2-yl-3-methyl-10-[(1S)-1-phenylethyl]-1,4,7,10,14-pentazacycloheptadecane-2,5,8,11,15-pentone |
| SMILES | CCC(C)N1CC(=O)N[C@@H](C)C(=O)NCCC(=O)NCCC(=O)N([C@@H](C)c2ccccc2)CC1=O |
| InChI | InChI=1S/C25H37N5O5/c1-5-17(2)29-15-22(32)28-18(3)25(35)27-13-11-21(31)26-14-12-23(33)30(16-24(29)34)19(4)20-9-7-6-8-10-20/h6-10,17-19H,5,11-16H2,1-4H3,(H,26,31)(H,27,35)(H,28,32)/t17?,18-,19-/m0/s1 |
| InChIKey | VYTMWPBCINNART-MNNMKWMVSA-N |
| XLogP | 0.73 |
| TPSA | 127.92 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 487.60 |
| LogP ≤ 5 | 0.73 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |