C44H30N2O2S2 — CID 24939228
(4S,5R)-2,7,12,17-tetraphenyl-21,23-dithia-22,24-diazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3(24),6,8,10,12,14,16(22),17,19-decaene-4,5-diol (PubChem CID 24939228) has the molecular formula C44H30N2O2S2 and a molecular weight of 682.87 g/mol. Its IUPAC name is (4S,5R)-2,7,12,17-tetraphenyl-21,23-dithia-22,24-diazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3(24),6,8,10,12,14,16(22),17,19-decaene-4,5-diol.
| Compound Name | (4S,5R)-2,7,12,17-tetraphenyl-21,23-dithia-22,24-diazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3(24),6,8,10,12,14,16(22),17,19-decaene-4,5-diol |
|---|---|
| PubChem CID | 24939228 |
| Molecular Formula | C44H30N2O2S2 |
| Molecular Weight | 682.87 g/mol |
| Exact Mass | 682.17 |
| IUPAC Name | (4S,5R)-2,7,12,17-tetraphenyl-21,23-dithia-22,24-diazapentacyclo[16.2.1.13,6.18,11.113,16]tetracosa-1,3(24),6,8,10,12,14,16(22),17,19-decaene-4,5-diol |
| SMILES | O[C@@H]1c2nc(c(-c3ccccc3)c3ccc(s3)c(-c3ccccc3)c3nc(c(-c4ccccc4)c4ccc(s4)c2-c2ccccc2)C=C3)[C@@H]1O |
| InChI | InChI=1S/C44H30N2O2S2/c47-43-41-39(29-17-9-3-10-18-29)35-25-23-33(49-35)37(27-13-5-1-6-14-27)31-21-22-32(45-31)38(28-15-7-2-8-16-28)34-24-26-36(50-34)40(42(46-41)44(43)48)30-19-11-4-12-20-30/h1-26,43-44,47-48H/b37-31-,37-33-,38-32-,38-34-,39-35-,40-36-,41-39-,42-40-/t43-,44+ |
| InChIKey | NTJNAQMAPAUPSA-OVEQEUOSSA-N |
| XLogP | 11.39 |
| TPSA | 66.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 682.87 |
| LogP ≤ 5 | 11.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |