C34H30O6S2 — CID 24940077
[32-(hydroxymethyl)-14,17,20,23-tetraoxa-9,28-dithiaheptacyclo[22.10.2.210,13.02,11.03,8.027,35.029,34]octatriaconta-1,3(8),4,6,10,12,24(36),25,27(35),29(34),30,32,37-tridecaen-5-yl]methanol (PubChem CID 24940077) has the molecular formula C34H30O6S2 and a molecular weight of 598.74 g/mol. Its IUPAC name is [32-(hydroxymethyl)-14,17,20,23-tetraoxa-9,28-dithiaheptacyclo[22.10.2.210,13.02,11.03,8.027,35.029,34]octatriaconta-1,3(8),4,6,10,12,24(36),25,27(35),29(34),30,32,37-tridecaen-5-yl]methanol.
| Compound Name | [32-(hydroxymethyl)-14,17,20,23-tetraoxa-9,28-dithiaheptacyclo[22.10.2.210,13.02,11.03,8.027,35.029,34]octatriaconta-1,3(8),4,6,10,12,24(36),25,27(35),29(34),30,32,37-tridecaen-5-yl]methanol |
|---|---|
| PubChem CID | 24940077 |
| Molecular Formula | C34H30O6S2 |
| Molecular Weight | 598.74 g/mol |
| Exact Mass | 598.15 |
| IUPAC Name | [32-(hydroxymethyl)-14,17,20,23-tetraoxa-9,28-dithiaheptacyclo[22.10.2.210,13.02,11.03,8.027,35.029,34]octatriaconta-1,3(8),4,6,10,12,24(36),25,27(35),29(34),30,32,37-tridecaen-5-yl]methanol |
| SMILES | OCc1ccc2c(c1)C1=C3c4cc(CO)ccc4Sc4ccc(cc43)OCCOCCOCCOc3ccc(c1c3)S2 |
| InChI | InChI=1S/C34H30O6S2/c35-19-21-1-5-29-25(15-21)33-27-17-23(3-7-31(27)41-29)39-13-11-37-9-10-38-12-14-40-24-4-8-32-28(18-24)34(33)26-16-22(20-36)2-6-30(26)42-32/h1-8,15-18,35-36H,9-14,19-20H2 |
| InChIKey | ZNFXZCKQEBSCAQ-UHFFFAOYSA-N |
| XLogP | 6.41 |
| TPSA | 77.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 598.74 |
| LogP ≤ 5 | 6.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'styrene_B(8)', 'substructure': 'N/A'}, {'alert_name': 'stilbene', 'substructure': 'N/A'} |
|---|