C22H28O3 — CID 24940311
(2R,10R,11R,14S,15S)-15-(2-hydroxyacetyl)-14-methylpentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5,16-dien-7-one (PubChem CID 24940311) has the molecular formula C22H28O3 and a molecular weight of 340.46 g/mol. Its IUPAC name is (2R,10R,11R,14S,15S)-15-(2-hydroxyacetyl)-14-methylpentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5,16-dien-7-one.
| Compound Name | (2R,10R,11R,14S,15S)-15-(2-hydroxyacetyl)-14-methylpentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5,16-dien-7-one |
|---|---|
| PubChem CID | 24940311 |
| Molecular Formula | C22H28O3 |
| Molecular Weight | 340.46 g/mol |
| Exact Mass | 340.20 |
| IUPAC Name | (2R,10R,11R,14S,15S)-15-(2-hydroxyacetyl)-14-methylpentacyclo[13.2.2.01,14.02,11.05,10]nonadeca-5,16-dien-7-one |
| SMILES | C[C@]12CC[C@H]3[C@@H](CCC4=CC(=O)CC[C@@H]43)C13C=C[C@@]2(C(=O)CO)CC3 |
| InChI | InChI=1S/C22H28O3/c1-20-7-6-17-16-4-3-15(24)12-14(16)2-5-18(17)21(20)8-10-22(20,11-9-21)19(25)13-23/h8,10,12,16-18,23H,2-7,9,11,13H2,1H3/t16-,17+,18+,20-,21?,22-/m0/s1 |
| InChIKey | QZVGKHLWWIBGAE-UKIXRDAESA-N |
| XLogP | 3.62 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.46 |
| LogP ≤ 5 | 3.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|