About barium(2+);bis(N-(3-methyl-1,1-dioxothiolan-3-yl)-N-prop-2-enylcarbamodithioate)
barium(2+);bis(N-(3-methyl-1,1-dioxothiolan-3-yl)-N-prop-2-enylcarbamodithioate) (PubChem CID 24940456) has the molecular formula C18H28BaN2O4S6
and a molecular weight of 666.16 g/mol. Its IUPAC name is barium(2+);bis(N-(3-methyl-1,1-dioxothiolan-3-yl)-N-prop-2-enylcarbamodithioate).
Molecular Properties
| Compound Name | barium(2+);bis(N-(3-methyl-1,1-dioxothiolan-3-yl)-N-prop-2-enylcarbamodithioate) |
| PubChem CID | 24940456 |
| Molecular Formula | C18H28BaN2O4S6 |
| Molecular Weight | 666.16 g/mol |
| Exact Mass | 665.94 |
| IUPAC Name | barium(2+);bis(N-(3-methyl-1,1-dioxothiolan-3-yl)-N-prop-2-enylcarbamodithioate) |
| SMILES | C=CCN(C(=S)[S-])C1(C)CCS(=O)(=O)C1.C=CCN(C(=S)[S-])C1(C)CCS(=O)(=O)C1.[Ba+2] |
| InChI | InChI=1S/2C9H15NO2S3.Ba/c2*1-3-5-10(8(13)14)9(2)4-6-15(11,12)7-9;/h2*3H,1,4-7H2,2H3,(H,13,14);/q;;+2/p-2 |
| InChIKey | FMHSYKQBIKEKHV-UHFFFAOYSA-L |
| XLogP | 1.39 |
| TPSA | 74.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 666.16 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_1', 'substructure': 'N/A'} |
|---|
Analyze barium(2+);bis(N-(3-methyl-1,1-dioxothiolan-3-yl)-N-prop-2-enylcarbamodithioate) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of barium(2+);bis(N-(3-methyl-1,1-dioxothiolan-3-yl)-N-prop-2-enylcarbamodithioate)?
The IUPAC name of barium(2+);bis(N-(3-methyl-1,1-dioxothiolan-3-yl)-N-prop-2-enylcarbamodithioate) (CID 24940456) is barium(2+);bis(N-(3-methyl-1,1-dioxothiolan-3-yl)-N-prop-2-enylcarbamodithioate).
What is the SMILES notation for barium(2+);bis(N-(3-methyl-1,1-dioxothiolan-3-yl)-N-prop-2-enylcarbamodithioate)?
The canonical SMILES for barium(2+);bis(N-(3-methyl-1,1-dioxothiolan-3-yl)-N-prop-2-enylcarbamodithioate) is C=CCN(C(=S)[S-])C1(C)CCS(=O)(=O)C1.C=CCN(C(=S)[S-])C1(C)CCS(=O)(=O)C1.[Ba+2].
What is the InChIKey of barium(2+);bis(N-(3-methyl-1,1-dioxothiolan-3-yl)-N-prop-2-enylcarbamodithioate)?
The InChIKey is FMHSYKQBIKEKHV-UHFFFAOYSA-L. The full InChI is InChI=1S/2C9H15NO2S3.Ba/c2*1-3-5-10(8(13)14)9(2)4-6-15(11,12)7-9;/h2*3H,1,4-7H2,2H3,(H,13,14);/q;;+2/p-2.
What are the key properties of barium(2+);bis(N-(3-methyl-1,1-dioxothiolan-3-yl)-N-prop-2-enylcarbamodithioate)?
barium(2+);bis(N-(3-methyl-1,1-dioxothiolan-3-yl)-N-prop-2-enylcarbamodithioate) has a molecular weight of 666.16 g/mol, XLogP of 1.39, 6 rotatable bonds, 0 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for barium(2+);bis(N-(3-methyl-1,1-dioxothiolan-3-yl)-N-prop-2-enylcarbamodithioate) is sourced from PubChem (CID 24940456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).