About zinc;decane;iodide
zinc;decane;iodide (PubChem CID 24941167) has the molecular formula C10H21IZn
and a molecular weight of 333.57 g/mol. Its IUPAC name is zinc;decane;iodide.
Molecular Properties
| Compound Name | zinc;decane;iodide |
| PubChem CID | 24941167 |
| Molecular Formula | C10H21IZn |
| Molecular Weight | 333.57 g/mol |
| Exact Mass | 332.00 |
| IUPAC Name | zinc;decane;iodide |
| SMILES | [CH2-]CCCCCCCCC.[I-].[Zn+2] |
| InChI | InChI=1S/C10H21.HI.Zn/c1-3-5-7-9-10-8-6-4-2;;/h1,3-10H2,2H3;1H;/q-1;;+2/p-1 |
| InChIKey | ZTAKRTGNQHBPQR-UHFFFAOYSA-M |
| XLogP | 0.96 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 333.57 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze zinc;decane;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;decane;iodide?
The IUPAC name of zinc;decane;iodide (CID 24941167) is zinc;decane;iodide.
What is the SMILES notation for zinc;decane;iodide?
The canonical SMILES for zinc;decane;iodide is [CH2-]CCCCCCCCC.[I-].[Zn+2].
What is the InChIKey of zinc;decane;iodide?
The InChIKey is ZTAKRTGNQHBPQR-UHFFFAOYSA-M. The full InChI is InChI=1S/C10H21.HI.Zn/c1-3-5-7-9-10-8-6-4-2;;/h1,3-10H2,2H3;1H;/q-1;;+2/p-1.
What are the key properties of zinc;decane;iodide?
zinc;decane;iodide has a molecular weight of 333.57 g/mol, XLogP of 0.96, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;decane;iodide is sourced from PubChem (CID 24941167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).