C10H14N2OS — CID 24941263
(3S)-3-propyl-2,3-dihydrothieno[2,3-f][1,4]oxazepin-5-amine (PubChem CID 24941263) has the molecular formula C10H14N2OS and a molecular weight of 210.30 g/mol. Its IUPAC name is (3S)-3-propyl-2,3-dihydrothieno[2,3-f][1,4]oxazepin-5-amine.
| Compound Name | (3S)-3-propyl-2,3-dihydrothieno[2,3-f][1,4]oxazepin-5-amine |
|---|---|
| PubChem CID | 24941263 |
| Molecular Formula | C10H14N2OS |
| Molecular Weight | 210.30 g/mol |
| Exact Mass | 210.08 |
| IUPAC Name | (3S)-3-propyl-2,3-dihydrothieno[2,3-f][1,4]oxazepin-5-amine |
| SMILES | CCC[C@H]1COc2ccsc2C(N)=N1 |
| InChI | InChI=1S/C10H14N2OS/c1-2-3-7-6-13-8-4-5-14-9(8)10(11)12-7/h4-5,7H,2-3,6H2,1H3,(H2,11,12)/t7-/m0/s1 |
| InChIKey | JIIBOYBTIWHZFJ-ZETCQYMHSA-N |
| XLogP | 2.01 |
| TPSA | 47.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 210.30 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |