C27H37N3O — CID 24941421
2-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-phenylmethyl]-N,N-diethylbenzamide (PubChem CID 24941421) has the molecular formula C27H37N3O and a molecular weight of 419.61 g/mol. Its IUPAC name is 2-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-phenylmethyl]-N,N-diethylbenzamide.
| Compound Name | 2-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-phenylmethyl]-N,N-diethylbenzamide |
|---|---|
| PubChem CID | 24941421 |
| Molecular Formula | C27H37N3O |
| Molecular Weight | 419.61 g/mol |
| Exact Mass | 419.29 |
| IUPAC Name | 2-[(R)-[(2S,5R)-2,5-dimethyl-4-prop-2-enylpiperazin-1-yl]-phenylmethyl]-N,N-diethylbenzamide |
| SMILES | C=CCN1C[C@H](C)N(C(c2ccccc2)c2ccccc2C(=O)N(CC)CC)C[C@H]1C |
| InChI | InChI=1S/C27H37N3O/c1-6-18-29-19-22(5)30(20-21(29)4)26(23-14-10-9-11-15-23)24-16-12-13-17-25(24)27(31)28(7-2)8-3/h6,9-17,21-22,26H,1,7-8,18-20H2,2-5H3/t21-,22+,26?/m1/s1 |
| InChIKey | FGXCEDIWHXFPSZ-SGNGHUOJSA-N |
| XLogP | 4.84 |
| TPSA | 26.79 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.61 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|