C20H30Mg — CID 24942212
magnesium bis(1,2,3,4,5-pentamethylcyclopenta-1,3-diene) (PubChem CID 24942212) has the molecular formula C20H30Mg and a molecular weight of 294.76 g/mol. Its IUPAC name is magnesium bis(1,2,3,4,5-pentamethylcyclopenta-1,3-diene).
| Compound Name | magnesium bis(1,2,3,4,5-pentamethylcyclopenta-1,3-diene) |
|---|---|
| PubChem CID | 24942212 |
| Molecular Formula | C20H30Mg |
| Molecular Weight | 294.76 g/mol |
| Exact Mass | 294.22 |
| IUPAC Name | magnesium bis(1,2,3,4,5-pentamethylcyclopenta-1,3-diene) |
| SMILES | Cc1c(C)c(C)[c-](C)c1C.Cc1c(C)c(C)[c-](C)c1C.[Mg+2] |
| InChI | InChI=1S/2C10H15.Mg/c2*1-6-7(2)9(4)10(5)8(6)3;/h2*1-5H3;/q2*-1;+2 |
| InChIKey | QZNMZKZCVOJICG-UHFFFAOYSA-N |
| XLogP | 5.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.76 |
| LogP ≤ 5 | 5.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|