About zinc;2-methanidylpropane;bromide
zinc;2-methanidylpropane;bromide (PubChem CID 24942246) has the molecular formula C4H9BrZn
and a molecular weight of 202.41 g/mol. Its IUPAC name is zinc;2-methanidylpropane;bromide.
Molecular Properties
| Compound Name | zinc;2-methanidylpropane;bromide |
|---|
| PubChem CID | 24942246 |
|---|
| Molecular Formula | C4H9BrZn |
|---|
| Molecular Weight | 202.41 g/mol |
|---|
| Exact Mass | 199.92 |
|---|
| IUPAC Name | zinc;2-methanidylpropane;bromide |
|---|
| SMILES | [Br-].[CH2-]C(C)C.[Zn+2] |
|---|
| InChI | InChI=1S/C4H9.BrH.Zn/c1-4(2)3;;/h4H,1H2,2-3H3;1H;/q-1;;+2/p-1 |
|---|
| InChIKey | DSDCDMKASWVZHI-UHFFFAOYSA-M |
|---|
| XLogP | -1.52 |
|---|
| TPSA | 0.00 Ų |
|---|
| H-Bond Donors | |
|---|
| H-Bond Acceptors | |
|---|
| Rotatable Bonds | |
|---|
| Heavy Atoms | 6 |
|---|
| Complexity | — |
|---|
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
|---|
| MW ≤ 500 | 202.41 |
| LogP ≤ 5 | -1.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|
Analyze zinc;2-methanidylpropane;bromide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of zinc;2-methanidylpropane;bromide?
The IUPAC name of zinc;2-methanidylpropane;bromide (CID 24942246) is zinc;2-methanidylpropane;bromide.
What is the SMILES notation for zinc;2-methanidylpropane;bromide?
The canonical SMILES for zinc;2-methanidylpropane;bromide is [Br-].[CH2-]C(C)C.[Zn+2].
What is the InChIKey of zinc;2-methanidylpropane;bromide?
The InChIKey is DSDCDMKASWVZHI-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H9.BrH.Zn/c1-4(2)3;;/h4H,1H2,2-3H3;1H;/q-1;;+2/p-1.
What are the key properties of zinc;2-methanidylpropane;bromide?
zinc;2-methanidylpropane;bromide has a molecular weight of 202.41 g/mol, XLogP of -1.52, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for zinc;2-methanidylpropane;bromide is sourced from PubChem (CID 24942246), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).