About copper bis(prop-1-ene)
copper bis(prop-1-ene) (PubChem CID 24942682) has the molecular formula C6H10Cu
and a molecular weight of 145.69 g/mol. Its IUPAC name is copper bis(prop-1-ene).
Molecular Properties
| Compound Name | copper bis(prop-1-ene) |
| PubChem CID | 24942682 |
| Molecular Formula | C6H10Cu |
| Molecular Weight | 145.69 g/mol |
| Exact Mass | 145.01 |
| IUPAC Name | copper bis(prop-1-ene) |
| SMILES | [Cu+2].[H]/[C-]=C\C.[H]/[C-]=C\C |
| InChI | InChI=1S/2C3H5.Cu/c2*1-3-2;/h2*1,3H,2H3;/q2*-1;+2 |
| InChIKey | PVUIAGQSCLZNOY-UHFFFAOYSA-N |
| XLogP | 1.99 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.69 |
| LogP ≤ 5 | 1.99 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'} |
|---|
Analyze copper bis(prop-1-ene) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of copper bis(prop-1-ene)?
The IUPAC name of copper bis(prop-1-ene) (CID 24942682) is copper bis(prop-1-ene).
What is the SMILES notation for copper bis(prop-1-ene)?
The canonical SMILES for copper bis(prop-1-ene) is [Cu+2].[H]/[C-]=C\C.[H]/[C-]=C\C.
What is the InChIKey of copper bis(prop-1-ene)?
The InChIKey is PVUIAGQSCLZNOY-UHFFFAOYSA-N. The full InChI is InChI=1S/2C3H5.Cu/c2*1-3-2;/h2*1,3H,2H3;/q2*-1;+2.
What are the key properties of copper bis(prop-1-ene)?
copper bis(prop-1-ene) has a molecular weight of 145.69 g/mol, XLogP of 1.99, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for copper bis(prop-1-ene) is sourced from PubChem (CID 24942682), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).