C13H13NO — CID 24944146
(1E,3Z,5E,7E)-5-methoxy-4-azabicyclo[6.4.1]trideca-1,3,5,7,9,11-hexaene (PubChem CID 24944146) has the molecular formula C13H13NO and a molecular weight of 199.25 g/mol. Its IUPAC name is (1E,3Z,5E,7E)-5-methoxy-4-azabicyclo[6.4.1]trideca-1,3,5,7,9,11-hexaene.
| Compound Name | (1E,3Z,5E,7E)-5-methoxy-4-azabicyclo[6.4.1]trideca-1,3,5,7,9,11-hexaene |
|---|---|
| PubChem CID | 24944146 |
| Molecular Formula | C13H13NO |
| Molecular Weight | 199.25 g/mol |
| Exact Mass | 199.10 |
| IUPAC Name | (1E,3Z,5E,7E)-5-methoxy-4-azabicyclo[6.4.1]trideca-1,3,5,7,9,11-hexaene |
| SMILES | COC1=C/C=C2/C=CC=C/C(=C\C=N/1)C2 |
| InChI | InChI=1S/C13H13NO/c1-15-13-7-6-11-4-2-3-5-12(10-11)8-9-14-13/h2-9H,10H2,1H3/b7-6-,9-8-,11-6-,12-8-,13-7+,14-9-,14-13+ |
| InChIKey | JADOWAUWALEJRL-JWWLEXJESA-N |
| XLogP | 2.93 |
| TPSA | 21.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.25 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |