C20H20N2O3S — CID 24944518
3-(1,1-dioxothian-4-yl)-5-phenyl-1H-indole-7-carboxamide (PubChem CID 24944518) has the molecular formula C20H20N2O3S and a molecular weight of 368.46 g/mol. Its IUPAC name is 3-(1,1-dioxothian-4-yl)-5-phenyl-1H-indole-7-carboxamide.
| Compound Name | 3-(1,1-dioxothian-4-yl)-5-phenyl-1H-indole-7-carboxamide |
|---|---|
| PubChem CID | 24944518 |
| Molecular Formula | C20H20N2O3S |
| Molecular Weight | 368.46 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | 3-(1,1-dioxothian-4-yl)-5-phenyl-1H-indole-7-carboxamide |
| SMILES | NC(=O)c1cc(-c2ccccc2)cc2c(C3CCS(=O)(=O)CC3)c[nH]c12 |
| InChI | InChI=1S/C20H20N2O3S/c21-20(23)17-11-15(13-4-2-1-3-5-13)10-16-18(12-22-19(16)17)14-6-8-26(24,25)9-7-14/h1-5,10-12,14,22H,6-9H2,(H2,21,23) |
| InChIKey | XNXQMKGGFGDFEC-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 93.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.46 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |