About N-[(1S)-1-[8-chloro-2-(1,3-thiazol-4-yl)quinolin-3-yl]ethyl]-7H-purin-6-amine
N-[(1S)-1-[8-chloro-2-(1,3-thiazol-4-yl)quinolin-3-yl]ethyl]-7H-purin-6-amine (PubChem CID 24944519) has the molecular formula C19H14ClN7S
and a molecular weight of 407.89 g/mol. Its IUPAC name is N-[(1S)-1-[8-chloro-2-(1,3-thiazol-4-yl)quinolin-3-yl]ethyl]-7H-purin-6-amine.
Molecular Properties
| Compound Name | N-[(1S)-1-[8-chloro-2-(1,3-thiazol-4-yl)quinolin-3-yl]ethyl]-7H-purin-6-amine |
| PubChem CID | 24944519 |
| Molecular Formula | C19H14ClN7S |
| Molecular Weight | 407.89 g/mol |
| Exact Mass | 407.07 |
| IUPAC Name | N-[(1S)-1-[8-chloro-2-(1,3-thiazol-4-yl)quinolin-3-yl]ethyl]-7H-purin-6-amine |
| SMILES | C[C@H](Nc1ncnc2nc[nH]c12)c1cc2cccc(Cl)c2nc1-c1cscn1 |
| InChI | InChI=1S/C19H14ClN7S/c1-10(26-19-17-18(22-7-21-17)23-8-24-19)12-5-11-3-2-4-13(20)15(11)27-16(12)14-6-28-9-25-14/h2-10H,1H3,(H2,21,22,23,24,26)/t10-/m0/s1 |
| InChIKey | KZYADSWFDHYKII-JTQLQIEISA-N |
| XLogP | 4.85 |
| TPSA | 92.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 407.89 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze N-[(1S)-1-[8-chloro-2-(1,3-thiazol-4-yl)quinolin-3-yl]ethyl]-7H-purin-6-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[(1S)-1-[8-chloro-2-(1,3-thiazol-4-yl)quinolin-3-yl]ethyl]-7H-purin-6-amine?
The IUPAC name of N-[(1S)-1-[8-chloro-2-(1,3-thiazol-4-yl)quinolin-3-yl]ethyl]-7H-purin-6-amine (CID 24944519) is N-[(1S)-1-[8-chloro-2-(1,3-thiazol-4-yl)quinolin-3-yl]ethyl]-7H-purin-6-amine.
What is the SMILES notation for N-[(1S)-1-[8-chloro-2-(1,3-thiazol-4-yl)quinolin-3-yl]ethyl]-7H-purin-6-amine?
The canonical SMILES for N-[(1S)-1-[8-chloro-2-(1,3-thiazol-4-yl)quinolin-3-yl]ethyl]-7H-purin-6-amine is C[C@H](Nc1ncnc2nc[nH]c12)c1cc2cccc(Cl)c2nc1-c1cscn1.
What is the InChIKey of N-[(1S)-1-[8-chloro-2-(1,3-thiazol-4-yl)quinolin-3-yl]ethyl]-7H-purin-6-amine?
The InChIKey is KZYADSWFDHYKII-JTQLQIEISA-N. The full InChI is InChI=1S/C19H14ClN7S/c1-10(26-19-17-18(22-7-21-17)23-8-24-19)12-5-11-3-2-4-13(20)15(11)27-16(12)14-6-28-9-25-14/h2-10H,1H3,(H2,21,22,23,24,26)/t10-/m0/s1.
What are the key properties of N-[(1S)-1-[8-chloro-2-(1,3-thiazol-4-yl)quinolin-3-yl]ethyl]-7H-purin-6-amine?
N-[(1S)-1-[8-chloro-2-(1,3-thiazol-4-yl)quinolin-3-yl]ethyl]-7H-purin-6-amine has a molecular weight of 407.89 g/mol, XLogP of 4.85, 4 rotatable bonds, 2 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for N-[(1S)-1-[8-chloro-2-(1,3-thiazol-4-yl)quinolin-3-yl]ethyl]-7H-purin-6-amine is sourced from PubChem (CID 24944519), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).