C22H25ClFN3O2 — CID 24944913
2-[6-chloro-2-[4-(3-(18F)fluoropropoxy)phenyl]imidazo[1,2-a]pyridin-3-yl]-N,N-diethylacetamide (PubChem CID 24944913) has the molecular formula C22H25ClFN3O2 and a molecular weight of 416.91 g/mol. Its IUPAC name is 2-[6-chloro-2-[4-(3-(18F)fluoropropoxy)phenyl]imidazo[1,2-a]pyridin-3-yl]-N,N-diethylacetamide.
| Compound Name | 2-[6-chloro-2-[4-(3-(18F)fluoropropoxy)phenyl]imidazo[1,2-a]pyridin-3-yl]-N,N-diethylacetamide |
|---|---|
| PubChem CID | 24944913 |
| Molecular Formula | C22H25ClFN3O2 |
| Molecular Weight | 416.91 g/mol |
| Exact Mass | 416.16 |
| IUPAC Name | 2-[6-chloro-2-[4-(3-(18F)fluoropropoxy)phenyl]imidazo[1,2-a]pyridin-3-yl]-N,N-diethylacetamide |
| SMILES | CCN(CC)C(=O)Cc1c(-c2ccc(OCCC[18F])cc2)nc2ccc(Cl)cn12 |
| InChI | InChI=1S/C22H25ClFN3O2/c1-3-26(4-2)21(28)14-19-22(25-20-11-8-17(23)15-27(19)20)16-6-9-18(10-7-16)29-13-5-12-24/h6-11,15H,3-5,12-14H2,1-2H3/i24-1 |
| InChIKey | YFXIZOLPHFYYMF-MIGPCILRSA-N |
| XLogP | 4.80 |
| TPSA | 46.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.91 |
| LogP ≤ 5 | 4.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|