C16H21NO3 — CID 24944962
(3aS,6E,10E,11aR)-N,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-6-carboxamide (PubChem CID 24944962) has the molecular formula C16H21NO3 and a molecular weight of 275.35 g/mol. Its IUPAC name is (3aS,6E,10E,11aR)-N,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-6-carboxamide.
| Compound Name | (3aS,6E,10E,11aR)-N,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-6-carboxamide |
|---|---|
| PubChem CID | 24944962 |
| Molecular Formula | C16H21NO3 |
| Molecular Weight | 275.35 g/mol |
| Exact Mass | 275.15 |
| IUPAC Name | (3aS,6E,10E,11aR)-N,10-dimethyl-3-methylidene-2-oxo-3a,4,5,8,9,11a-hexahydrocyclodeca[b]furan-6-carboxamide |
| SMILES | C=C1C(=O)O[C@@H]2/C=C(\C)CC/C=C(/C(=O)NC)CC[C@@H]12 |
| InChI | InChI=1S/C16H21NO3/c1-10-5-4-6-12(15(18)17-3)7-8-13-11(2)16(19)20-14(13)9-10/h6,9,13-14H,2,4-5,7-8H2,1,3H3,(H,17,18)/b10-9+,12-6+/t13-,14+/m0/s1 |
| InChIKey | OHJGVTMCGJOURL-QRIDBXFVSA-N |
| XLogP | 2.28 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.35 |
| LogP ≤ 5 | 2.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|