About cyclohexyl-[4-(3,5-dimethylphenyl)sulfonylpiperazin-1-yl]methanone
cyclohexyl-[4-(3,5-dimethylphenyl)sulfonylpiperazin-1-yl]methanone (PubChem CID 24944970) has the molecular formula C19H28N2O3S
and a molecular weight of 364.51 g/mol. Its IUPAC name is cyclohexyl-[4-(3,5-dimethylphenyl)sulfonylpiperazin-1-yl]methanone.
Molecular Properties
| Compound Name | cyclohexyl-[4-(3,5-dimethylphenyl)sulfonylpiperazin-1-yl]methanone |
| PubChem CID | 24944970 |
| Molecular Formula | C19H28N2O3S |
| Molecular Weight | 364.51 g/mol |
| Exact Mass | 364.18 |
| IUPAC Name | cyclohexyl-[4-(3,5-dimethylphenyl)sulfonylpiperazin-1-yl]methanone |
| SMILES | Cc1cc(C)cc(S(=O)(=O)N2CCN(C(=O)C3CCCCC3)CC2)c1 |
| InChI | InChI=1S/C19H28N2O3S/c1-15-12-16(2)14-18(13-15)25(23,24)21-10-8-20(9-11-21)19(22)17-6-4-3-5-7-17/h12-14,17H,3-11H2,1-2H3 |
| InChIKey | NYZNFOXDFMTATA-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 57.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 364.51 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze cyclohexyl-[4-(3,5-dimethylphenyl)sulfonylpiperazin-1-yl]methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of cyclohexyl-[4-(3,5-dimethylphenyl)sulfonylpiperazin-1-yl]methanone?
The IUPAC name of cyclohexyl-[4-(3,5-dimethylphenyl)sulfonylpiperazin-1-yl]methanone (CID 24944970) is cyclohexyl-[4-(3,5-dimethylphenyl)sulfonylpiperazin-1-yl]methanone.
What is the SMILES notation for cyclohexyl-[4-(3,5-dimethylphenyl)sulfonylpiperazin-1-yl]methanone?
The canonical SMILES for cyclohexyl-[4-(3,5-dimethylphenyl)sulfonylpiperazin-1-yl]methanone is Cc1cc(C)cc(S(=O)(=O)N2CCN(C(=O)C3CCCCC3)CC2)c1.
What is the InChIKey of cyclohexyl-[4-(3,5-dimethylphenyl)sulfonylpiperazin-1-yl]methanone?
The InChIKey is NYZNFOXDFMTATA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H28N2O3S/c1-15-12-16(2)14-18(13-15)25(23,24)21-10-8-20(9-11-21)19(22)17-6-4-3-5-7-17/h12-14,17H,3-11H2,1-2H3.
What are the key properties of cyclohexyl-[4-(3,5-dimethylphenyl)sulfonylpiperazin-1-yl]methanone?
cyclohexyl-[4-(3,5-dimethylphenyl)sulfonylpiperazin-1-yl]methanone has a molecular weight of 364.51 g/mol, XLogP of 2.72, 3 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for cyclohexyl-[4-(3,5-dimethylphenyl)sulfonylpiperazin-1-yl]methanone is sourced from PubChem (CID 24944970), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).