C17H18N2O2 — CID 24945034
2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-(4-phenylfuran-2-yl)methanone (PubChem CID 24945034) has the molecular formula C17H18N2O2 and a molecular weight of 282.34 g/mol. Its IUPAC name is 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-(4-phenylfuran-2-yl)methanone.
| Compound Name | 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-(4-phenylfuran-2-yl)methanone |
|---|---|
| PubChem CID | 24945034 |
| Molecular Formula | C17H18N2O2 |
| Molecular Weight | 282.34 g/mol |
| Exact Mass | 282.14 |
| IUPAC Name | 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl-(4-phenylfuran-2-yl)methanone |
| SMILES | O=C(c1cc(-c2ccccc2)co1)N1CC2CNCC2C1 |
| InChI | InChI=1S/C17H18N2O2/c20-17(19-9-14-7-18-8-15(14)10-19)16-6-13(11-21-16)12-4-2-1-3-5-12/h1-6,11,14-15,18H,7-10H2 |
| InChIKey | VZTZBWKJSNARCS-UHFFFAOYSA-N |
| XLogP | 2.24 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.34 |
| LogP ≤ 5 | 2.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |