C10H13N3O2 — CID 24945126
2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl(1,3-oxazol-5-yl)methanone (PubChem CID 24945126) has the molecular formula C10H13N3O2 and a molecular weight of 207.23 g/mol. Its IUPAC name is 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl(1,3-oxazol-5-yl)methanone.
| Compound Name | 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl(1,3-oxazol-5-yl)methanone |
|---|---|
| PubChem CID | 24945126 |
| Molecular Formula | C10H13N3O2 |
| Molecular Weight | 207.23 g/mol |
| Exact Mass | 207.10 |
| IUPAC Name | 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl(1,3-oxazol-5-yl)methanone |
| SMILES | O=C(c1cnco1)N1CC2CNCC2C1 |
| InChI | InChI=1S/C10H13N3O2/c14-10(9-3-12-6-15-9)13-4-7-1-11-2-8(7)5-13/h3,6-8,11H,1-2,4-5H2 |
| InChIKey | CRHHYTWGPWXCHF-UHFFFAOYSA-N |
| XLogP | -0.03 |
| TPSA | 58.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 207.23 |
| LogP ≤ 5 | -0.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |