C9H12N4O2 — CID 24945212
2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl(1,3,4-oxadiazol-2-yl)methanone (PubChem CID 24945212) has the molecular formula C9H12N4O2 and a molecular weight of 208.22 g/mol. Its IUPAC name is 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl(1,3,4-oxadiazol-2-yl)methanone.
| Compound Name | 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl(1,3,4-oxadiazol-2-yl)methanone |
|---|---|
| PubChem CID | 24945212 |
| Molecular Formula | C9H12N4O2 |
| Molecular Weight | 208.22 g/mol |
| Exact Mass | 208.10 |
| IUPAC Name | 2,3,3a,4,6,6a-hexahydro-1H-pyrrolo[3,4-c]pyrrol-5-yl(1,3,4-oxadiazol-2-yl)methanone |
| SMILES | O=C(c1nnco1)N1CC2CNCC2C1 |
| InChI | InChI=1S/C9H12N4O2/c14-9(8-12-11-5-15-8)13-3-6-1-10-2-7(6)4-13/h5-7,10H,1-4H2 |
| InChIKey | HWSQOKGBQJLNMR-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 71.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 208.22 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |