About (5-chlorofuran-2-yl)-(3,7-diazabicyclo[3.3.1]nonan-3-yl)methanone
(5-chlorofuran-2-yl)-(3,7-diazabicyclo[3.3.1]nonan-3-yl)methanone (PubChem CID 24945301) has the molecular formula C12H15ClN2O2
and a molecular weight of 254.72 g/mol. Its IUPAC name is (5-chlorofuran-2-yl)-(3,7-diazabicyclo[3.3.1]nonan-3-yl)methanone.
Molecular Properties
| Compound Name | (5-chlorofuran-2-yl)-(3,7-diazabicyclo[3.3.1]nonan-3-yl)methanone |
| PubChem CID | 24945301 |
| Molecular Formula | C12H15ClN2O2 |
| Molecular Weight | 254.72 g/mol |
| Exact Mass | 254.08 |
| IUPAC Name | (5-chlorofuran-2-yl)-(3,7-diazabicyclo[3.3.1]nonan-3-yl)methanone |
| SMILES | O=C(c1ccc(Cl)o1)N1CC2CNCC(C2)C1 |
| InChI | InChI=1S/C12H15ClN2O2/c13-11-2-1-10(17-11)12(16)15-6-8-3-9(7-15)5-14-4-8/h1-2,8-9,14H,3-7H2 |
| InChIKey | AFIZEQKQIKDZQH-UHFFFAOYSA-N |
| XLogP | 1.61 |
| TPSA | 45.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 254.72 |
| LogP ≤ 5 | 1.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (5-chlorofuran-2-yl)-(3,7-diazabicyclo[3.3.1]nonan-3-yl)methanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (5-chlorofuran-2-yl)-(3,7-diazabicyclo[3.3.1]nonan-3-yl)methanone?
The IUPAC name of (5-chlorofuran-2-yl)-(3,7-diazabicyclo[3.3.1]nonan-3-yl)methanone (CID 24945301) is (5-chlorofuran-2-yl)-(3,7-diazabicyclo[3.3.1]nonan-3-yl)methanone.
What is the SMILES notation for (5-chlorofuran-2-yl)-(3,7-diazabicyclo[3.3.1]nonan-3-yl)methanone?
The canonical SMILES for (5-chlorofuran-2-yl)-(3,7-diazabicyclo[3.3.1]nonan-3-yl)methanone is O=C(c1ccc(Cl)o1)N1CC2CNCC(C2)C1.
What is the InChIKey of (5-chlorofuran-2-yl)-(3,7-diazabicyclo[3.3.1]nonan-3-yl)methanone?
The InChIKey is AFIZEQKQIKDZQH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15ClN2O2/c13-11-2-1-10(17-11)12(16)15-6-8-3-9(7-15)5-14-4-8/h1-2,8-9,14H,3-7H2.
What are the key properties of (5-chlorofuran-2-yl)-(3,7-diazabicyclo[3.3.1]nonan-3-yl)methanone?
(5-chlorofuran-2-yl)-(3,7-diazabicyclo[3.3.1]nonan-3-yl)methanone has a molecular weight of 254.72 g/mol, XLogP of 1.61, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (5-chlorofuran-2-yl)-(3,7-diazabicyclo[3.3.1]nonan-3-yl)methanone is sourced from PubChem (CID 24945301), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).